About [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate
[6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate (PubChem CID 171523924) has the molecular formula C16H17F4N3O3
and a molecular weight of 375.32 g/mol. Its IUPAC name is [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate |
| PubChem CID | 171523924 |
| Molecular Formula | C16H17F4N3O3 |
| Molecular Weight | 375.32 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate |
| SMILES | O=C(Oc1ccc(C(F)F)nc1)N1C[C@H](N2CCCC2=O)CC(F)(F)C1 |
| InChI | InChI=1S/C16H17F4N3O3/c17-14(18)12-4-3-11(7-21-12)26-15(25)22-8-10(6-16(19,20)9-22)23-5-1-2-13(23)24/h3-4,7,10,14H,1-2,5-6,8-9H2/t10-/m1/s1 |
| InChIKey | LJGBMHONQWRXLO-SNVBAGLBSA-N |
| XLogP | 2.85 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate?
The IUPAC name of [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate (CID 171523924) is [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate.
What is the SMILES notation for [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate?
The canonical SMILES for [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate is O=C(Oc1ccc(C(F)F)nc1)N1C[C@H](N2CCCC2=O)CC(F)(F)C1.
What is the InChIKey of [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate?
The InChIKey is LJGBMHONQWRXLO-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H17F4N3O3/c17-14(18)12-4-3-11(7-21-12)26-15(25)22-8-10(6-16(19,20)9-22)23-5-1-2-13(23)24/h3-4,7,10,14H,1-2,5-6,8-9H2/t10-/m1/s1.
What are the key properties of [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate?
[6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate has a molecular weight of 375.32 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(difluoromethyl)-3-pyridinyl] (5R)-3,3-difluoro-5-(2-oxopyrrolidin-1-yl)piperidine-1-carboxylate is sourced from PubChem (CID 171523924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).