About (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate
(5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate (PubChem CID 171524146) has the molecular formula C20H26ClF2N2O3+
and a molecular weight of 415.89 g/mol. Its IUPAC name is (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate.
Molecular Properties
| Compound Name | (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate |
| PubChem CID | 171524146 |
| Molecular Formula | C20H26ClF2N2O3+ |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate |
| SMILES | CC(C(=O)Oc1ccc(Cl)cn1)C1CCC([NH+]2CCCCC2=O)CC(F)(F)C1 |
| InChI | InChI=1S/C20H25ClF2N2O3/c1-13(19(27)28-17-8-6-15(21)12-24-17)14-5-7-16(11-20(22,23)10-14)25-9-3-2-4-18(25)26/h6,8,12-14,16H,2-5,7,9-11H2,1H3/p+1 |
| InChIKey | YLIFFTSVTIPSLI-UHFFFAOYSA-O |
| XLogP | 3.07 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate?
The IUPAC name of (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate (CID 171524146) is (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate.
What is the SMILES notation for (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate?
The canonical SMILES for (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate is CC(C(=O)Oc1ccc(Cl)cn1)C1CCC([NH+]2CCCCC2=O)CC(F)(F)C1.
What is the InChIKey of (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate?
The InChIKey is YLIFFTSVTIPSLI-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H25ClF2N2O3/c1-13(19(27)28-17-8-6-15(21)12-24-17)14-5-7-16(11-20(22,23)10-14)25-9-3-2-4-18(25)26/h6,8,12-14,16H,2-5,7,9-11H2,1H3/p+1.
What are the key properties of (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate?
(5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate has a molecular weight of 415.89 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2-pyridinyl) 2-[3,3-difluoro-5-(2-oxopiperidin-1-ium-1-yl)cycloheptyl]propanoate is sourced from PubChem (CID 171524146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).