About 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine
1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine (PubChem CID 171524841) has the molecular formula C13H15BrF2N2
and a molecular weight of 317.18 g/mol. Its IUPAC name is 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine.
Molecular Properties
| Compound Name | 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine |
| PubChem CID | 171524841 |
| Molecular Formula | C13H15BrF2N2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine |
| SMILES | FC1(F)Cc2cc(Br)ccc2C1N1CCNCC1 |
| InChI | InChI=1S/C13H15BrF2N2/c14-10-1-2-11-9(7-10)8-13(15,16)12(11)18-5-3-17-4-6-18/h1-2,7,12,17H,3-6,8H2 |
| InChIKey | QWJNLRCOFQTUEZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine?
The IUPAC name of 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine (CID 171524841) is 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine.
What is the SMILES notation for 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine?
The canonical SMILES for 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine is FC1(F)Cc2cc(Br)ccc2C1N1CCNCC1.
What is the InChIKey of 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine?
The InChIKey is QWJNLRCOFQTUEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrF2N2/c14-10-1-2-11-9(7-10)8-13(15,16)12(11)18-5-3-17-4-6-18/h1-2,7,12,17H,3-6,8H2.
What are the key properties of 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine?
1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine has a molecular weight of 317.18 g/mol, XLogP of 2.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-2,2-difluoro-1,3-dihydroinden-1-yl)piperazine is sourced from PubChem (CID 171524841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).