About 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one
5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one (PubChem CID 171524947) has the molecular formula C14H18BrN3O
and a molecular weight of 324.22 g/mol. Its IUPAC name is 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one.
Molecular Properties
| Compound Name | 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one |
| PubChem CID | 171524947 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one |
| SMILES | CC1(C)C(=O)N(C2CCNCC2)c2ccc(Br)nc21 |
| InChI | InChI=1S/C14H18BrN3O/c1-14(2)12-10(3-4-11(15)17-12)18(13(14)19)9-5-7-16-8-6-9/h3-4,9,16H,5-8H2,1-2H3 |
| InChIKey | KTZGIRLXMQPWEV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one?
The IUPAC name of 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one (CID 171524947) is 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one.
What is the SMILES notation for 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one?
The canonical SMILES for 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one is CC1(C)C(=O)N(C2CCNCC2)c2ccc(Br)nc21.
What is the InChIKey of 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one?
The InChIKey is KTZGIRLXMQPWEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrN3O/c1-14(2)12-10(3-4-11(15)17-12)18(13(14)19)9-5-7-16-8-6-9/h3-4,9,16H,5-8H2,1-2H3.
What are the key properties of 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one?
5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one has a molecular weight of 324.22 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,3-dimethyl-1-piperidin-4-ylpyrrolo[3,2-b]pyridin-2-one is sourced from PubChem (CID 171524947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).