C14H19BrN2 — CID 171525009
6-bromo-1-piperidin-4-yl-3,4-dihydro-2H-quinoline (PubChem CID 171525009) has the molecular formula C14H19BrN2 and a molecular weight of 295.22 g/mol. Its IUPAC name is 6-bromo-1-piperidin-4-yl-3,4-dihydro-2H-quinoline.
| Compound Name | 6-bromo-1-piperidin-4-yl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 171525009 |
| Molecular Formula | C14H19BrN2 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 6-bromo-1-piperidin-4-yl-3,4-dihydro-2H-quinoline |
| SMILES | Brc1ccc2c(c1)CCCN2C1CCNCC1 |
| InChI | InChI=1S/C14H19BrN2/c15-12-3-4-14-11(10-12)2-1-9-17(14)13-5-7-16-8-6-13/h3-4,10,13,16H,1-2,5-9H2 |
| InChIKey | DQDOSSGXUNKPFZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |