About [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate
[2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate (PubChem CID 171526459) has the molecular formula C17H23FO3
and a molecular weight of 294.37 g/mol. Its IUPAC name is [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate |
| PubChem CID | 171526459 |
| Molecular Formula | C17H23FO3 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate |
| SMILES | Cc1cc(C)c(C(C)(C)CC(=O)F)c(OC(=O)C(C)C)c1 |
| InChI | InChI=1S/C17H23FO3/c1-10(2)16(20)21-13-8-11(3)7-12(4)15(13)17(5,6)9-14(18)19/h7-8,10H,9H2,1-6H3 |
| InChIKey | PLVJGLGKNIMYFM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate?
The IUPAC name of [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate (CID 171526459) is [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate.
What is the SMILES notation for [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate?
The canonical SMILES for [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate is Cc1cc(C)c(C(C)(C)CC(=O)F)c(OC(=O)C(C)C)c1.
What is the InChIKey of [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate?
The InChIKey is PLVJGLGKNIMYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23FO3/c1-10(2)16(20)21-13-8-11(3)7-12(4)15(13)17(5,6)9-14(18)19/h7-8,10H,9H2,1-6H3.
What are the key properties of [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate?
[2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate has a molecular weight of 294.37 g/mol, XLogP of 4.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluoro-2-methyl-4-oxobutan-2-yl)-3,5-dimethylphenyl] 2-methylpropanoate is sourced from PubChem (CID 171526459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).