C14H15BN2O4S — CID 171526660
[3-methoxy-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid (PubChem CID 171526660) has the molecular formula C14H15BN2O4S and a molecular weight of 318.16 g/mol. Its IUPAC name is [3-methoxy-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid.
| Compound Name | [3-methoxy-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 171526660 |
| Molecular Formula | C14H15BN2O4S |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | [3-methoxy-4-(4-oxo-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-2-yl)phenyl]boronic acid |
| SMILES | COc1cc(B(O)O)ccc1-c1nc2c(c(=O)[nH]1)CSCC2 |
| InChI | InChI=1S/C14H15BN2O4S/c1-21-12-6-8(15(19)20)2-3-9(12)13-16-11-4-5-22-7-10(11)14(18)17-13/h2-3,6,19-20H,4-5,7H2,1H3,(H,16,17,18) |
| InChIKey | PWCYNTCFVRTUPU-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|