C26H29BN2O4S — CID 171526726
2-[4-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one (PubChem CID 171526726) has the molecular formula C26H29BN2O4S and a molecular weight of 476.41 g/mol. Its IUPAC name is 2-[4-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one.
| Compound Name | 2-[4-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 171526726 |
| Molecular Formula | C26H29BN2O4S |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 2-[4-[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-3,5,7,8-tetrahydrothiopyrano[4,3-d]pyrimidin-4-one |
| SMILES | COc1cc(-c2ccc(-c3nc4c(c(=O)[nH]3)CSCC4)cc2)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C26H29BN2O4S/c1-25(2)26(3,4)33-27(32-25)20-11-10-18(14-22(20)31-5)16-6-8-17(9-7-16)23-28-21-12-13-34-15-19(21)24(30)29-23/h6-11,14H,12-13,15H2,1-5H3,(H,28,29,30) |
| InChIKey | ZJJJVMCLSVJIAO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|