C13H16FN3O2S — CID 171526846
7-fluoro-1,1-dioxo-N-(1-propan-2-ylcyclopropyl)-4H-1λ6,2,4-benzothiadiazin-3-imine (PubChem CID 171526846) has the molecular formula C13H16FN3O2S and a molecular weight of 297.35 g/mol. Its IUPAC name is 7-fluoro-1,1-dioxo-N-(1-propan-2-ylcyclopropyl)-4H-1λ6,2,4-benzothiadiazin-3-imine.
| Compound Name | 7-fluoro-1,1-dioxo-N-(1-propan-2-ylcyclopropyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
|---|---|
| PubChem CID | 171526846 |
| Molecular Formula | C13H16FN3O2S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 7-fluoro-1,1-dioxo-N-(1-propan-2-ylcyclopropyl)-4H-1λ6,2,4-benzothiadiazin-3-imine |
| SMILES | CC(C)C1(/N=C2\Nc3ccc(F)cc3S(=O)(=O)N2)CC1 |
| InChI | InChI=1S/C13H16FN3O2S/c1-8(2)13(5-6-13)16-12-15-10-4-3-9(14)7-11(10)20(18,19)17-12/h3-4,7-8H,5-6H2,1-2H3,(H2,15,16,17) |
| InChIKey | LBAVFRQILPEXPJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|