C11H18BFN2O2 — CID 171526962
1-ethyl-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 171526962) has the molecular formula C11H18BFN2O2 and a molecular weight of 240.09 g/mol. Its IUPAC name is 1-ethyl-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-ethyl-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 171526962 |
| Molecular Formula | C11H18BFN2O2 |
| Molecular Weight | 240.09 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 1-ethyl-3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CCn1cc(B2OC(C)(C)C(C)(C)O2)c(F)n1 |
| InChI | InChI=1S/C11H18BFN2O2/c1-6-15-7-8(9(13)14-15)12-16-10(2,3)11(4,5)17-12/h7H,6H2,1-5H3 |
| InChIKey | NXJWEHZXJYAQOE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.09 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|