About 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane
3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane (PubChem CID 171527026) has the molecular formula C12H20N2O3
and a molecular weight of 240.30 g/mol. Its IUPAC name is 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane.
Molecular Properties
| Compound Name | 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane |
| PubChem CID | 171527026 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane |
| SMILES | CC.CC.Cc1cnc2c(c1)C(O)(O)C(=O)N2 |
| InChI | InChI=1S/C8H8N2O3.2C2H6/c1-4-2-5-6(9-3-4)10-7(11)8(5,12)13;2*1-2/h2-3,12-13H,1H3,(H,9,10,11);2*1-2H3 |
| InChIKey | GUEUSGCSNAGECF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane?
The IUPAC name of 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane (CID 171527026) is 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane.
What is the SMILES notation for 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane?
The canonical SMILES for 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane is CC.CC.Cc1cnc2c(c1)C(O)(O)C(=O)N2.
What is the InChIKey of 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane?
The InChIKey is GUEUSGCSNAGECF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3.2C2H6/c1-4-2-5-6(9-3-4)10-7(11)8(5,12)13;2*1-2/h2-3,12-13H,1H3,(H,9,10,11);2*1-2H3.
What are the key properties of 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane?
3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane has a molecular weight of 240.30 g/mol, XLogP of 1.53, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dihydroxy-5-methyl-1H-pyrrolo[2,3-b]pyridin-2-one;ethane is sourced from PubChem (CID 171527026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).