About 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane
5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane (PubChem CID 171527079) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane.
Molecular Properties
| Compound Name | 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane |
| PubChem CID | 171527079 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane |
| SMILES | CCC.Cc1ccc(-c2nncn2C)nc1 |
| InChI | InChI=1S/C9H10N4.C3H8/c1-7-3-4-8(10-5-7)9-12-11-6-13(9)2;1-3-2/h3-6H,1-2H3;3H2,1-2H3 |
| InChIKey | NNPRGOQGZHICRM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane?
The IUPAC name of 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane (CID 171527079) is 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane.
What is the SMILES notation for 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane?
The canonical SMILES for 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane is CCC.Cc1ccc(-c2nncn2C)nc1.
What is the InChIKey of 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane?
The InChIKey is NNPRGOQGZHICRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4.C3H8/c1-7-3-4-8(10-5-7)9-12-11-6-13(9)2;1-3-2/h3-6H,1-2H3;3H2,1-2H3.
What are the key properties of 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane?
5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane has a molecular weight of 218.30 g/mol, XLogP of 2.60, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(4-methyl-1,2,4-triazol-3-yl)pyridine;propane is sourced from PubChem (CID 171527079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).