About (2-aminopyrimidin-5-yl)boronic acid;ethanamine
(2-aminopyrimidin-5-yl)boronic acid;ethanamine (PubChem CID 171527121) has the molecular formula C6H13BN4O2
and a molecular weight of 184.01 g/mol. Its IUPAC name is (2-aminopyrimidin-5-yl)boronic acid;ethanamine.
Molecular Properties
| Compound Name | (2-aminopyrimidin-5-yl)boronic acid;ethanamine |
| PubChem CID | 171527121 |
| Molecular Formula | C6H13BN4O2 |
| Molecular Weight | 184.01 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (2-aminopyrimidin-5-yl)boronic acid;ethanamine |
| SMILES | CCN.Nc1ncc(B(O)O)cn1 |
| InChI | InChI=1S/C4H6BN3O2.C2H7N/c6-4-7-1-3(2-8-4)5(9)10;1-2-3/h1-2,9-10H,(H2,6,7,8);2-3H2,1H3 |
| InChIKey | IDGUPOPWCXQJRF-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.01 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-aminopyrimidin-5-yl)boronic acid;ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminopyrimidin-5-yl)boronic acid;ethanamine?
The IUPAC name of (2-aminopyrimidin-5-yl)boronic acid;ethanamine (CID 171527121) is (2-aminopyrimidin-5-yl)boronic acid;ethanamine.
What is the SMILES notation for (2-aminopyrimidin-5-yl)boronic acid;ethanamine?
The canonical SMILES for (2-aminopyrimidin-5-yl)boronic acid;ethanamine is CCN.Nc1ncc(B(O)O)cn1.
What is the InChIKey of (2-aminopyrimidin-5-yl)boronic acid;ethanamine?
The InChIKey is IDGUPOPWCXQJRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6BN3O2.C2H7N/c6-4-7-1-3(2-8-4)5(9)10;1-2-3/h1-2,9-10H,(H2,6,7,8);2-3H2,1H3.
What are the key properties of (2-aminopyrimidin-5-yl)boronic acid;ethanamine?
(2-aminopyrimidin-5-yl)boronic acid;ethanamine has a molecular weight of 184.01 g/mol, XLogP of -2.30, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminopyrimidin-5-yl)boronic acid;ethanamine is sourced from PubChem (CID 171527121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).