About ethane;7-fluoro-2,3-dihydro-1H-indole
ethane;7-fluoro-2,3-dihydro-1H-indole (PubChem CID 171527172) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is ethane;7-fluoro-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | ethane;7-fluoro-2,3-dihydro-1H-indole |
| PubChem CID | 171527172 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | ethane;7-fluoro-2,3-dihydro-1H-indole |
| SMILES | CC.Fc1cccc2c1NCC2 |
| InChI | InChI=1S/C8H8FN.C2H6/c9-7-3-1-2-6-4-5-10-8(6)7;1-2/h1-3,10H,4-5H2;1-2H3 |
| InChIKey | DVKRLJRGFROLFH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;7-fluoro-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-fluoro-2,3-dihydro-1H-indole?
The IUPAC name of ethane;7-fluoro-2,3-dihydro-1H-indole (CID 171527172) is ethane;7-fluoro-2,3-dihydro-1H-indole.
What is the SMILES notation for ethane;7-fluoro-2,3-dihydro-1H-indole?
The canonical SMILES for ethane;7-fluoro-2,3-dihydro-1H-indole is CC.Fc1cccc2c1NCC2.
What is the InChIKey of ethane;7-fluoro-2,3-dihydro-1H-indole?
The InChIKey is DVKRLJRGFROLFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN.C2H6/c9-7-3-1-2-6-4-5-10-8(6)7;1-2/h1-3,10H,4-5H2;1-2H3.
What are the key properties of ethane;7-fluoro-2,3-dihydro-1H-indole?
ethane;7-fluoro-2,3-dihydro-1H-indole has a molecular weight of 167.23 g/mol, XLogP of 2.82, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-fluoro-2,3-dihydro-1H-indole is sourced from PubChem (CID 171527172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).