C23H14ClFN6O — CID 171527249
5-[4-(6-chloro-5-fluoro-2,3-dihydroindol-1-yl)quinazolin-6-yl]-N-cyanopyridine-3-carboxamide (PubChem CID 171527249) has the molecular formula C23H14ClFN6O and a molecular weight of 444.86 g/mol. Its IUPAC name is 5-[4-(6-chloro-5-fluoro-2,3-dihydroindol-1-yl)quinazolin-6-yl]-N-cyanopyridine-3-carboxamide.
| Compound Name | 5-[4-(6-chloro-5-fluoro-2,3-dihydroindol-1-yl)quinazolin-6-yl]-N-cyanopyridine-3-carboxamide |
|---|---|
| PubChem CID | 171527249 |
| Molecular Formula | C23H14ClFN6O |
| Molecular Weight | 444.86 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 5-[4-(6-chloro-5-fluoro-2,3-dihydroindol-1-yl)quinazolin-6-yl]-N-cyanopyridine-3-carboxamide |
| SMILES | N#CNC(=O)c1cncc(-c2ccc3ncnc(N4CCc5cc(F)c(Cl)cc54)c3c2)c1 |
| InChI | InChI=1S/C23H14ClFN6O/c24-18-8-21-14(7-19(18)25)3-4-31(21)22-17-6-13(1-2-20(17)29-12-30-22)15-5-16(10-27-9-15)23(32)28-11-26/h1-2,5-10,12H,3-4H2,(H,28,32) |
| InChIKey | NKSKGKYRZNFOCK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.86 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|