C12H19BN3O2 — CID 171527286
CID 171527286 (PubChem CID 171527286) has the molecular formula C12H19BN3O2 and a molecular weight of 248.12 g/mol.
| Compound Name | CID 171527286 |
|---|---|
| PubChem CID | 171527286 |
| Molecular Formula | C12H19BN3O2 |
| Molecular Weight | 248.12 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | — |
| SMILES | [H]/N=C/c1cc([B]OC(C)(C)C(C)(C)O)cnc1N |
| InChI | InChI=1S/C12H19BN3O2/c1-11(2,17)12(3,4)18-13-9-5-8(6-14)10(15)16-7-9/h5-7,14,17H,1-4H3,(H2,15,16)/b14-6+ |
| InChIKey | XDDISKRKMDUVCV-MKMNVTDBSA-N |
| XLogP | 0.47 |
| TPSA | 92.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.12 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|