C26H32N4O4 — CID 171527424
6-but-3-enyl-4-[4-(4-ethylpiperazine-1-carbonyl)-2,5-dimethoxyphenyl]-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 171527424) has the molecular formula C26H32N4O4 and a molecular weight of 464.57 g/mol. Its IUPAC name is 6-but-3-enyl-4-[4-(4-ethylpiperazine-1-carbonyl)-2,5-dimethoxyphenyl]-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 6-but-3-enyl-4-[4-(4-ethylpiperazine-1-carbonyl)-2,5-dimethoxyphenyl]-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 171527424 |
| Molecular Formula | C26H32N4O4 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 6-but-3-enyl-4-[4-(4-ethylpiperazine-1-carbonyl)-2,5-dimethoxyphenyl]-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | C=CCCn1cc(-c2cc(OC)c(C(=O)N3CCN(CC)CC3)cc2OC)c2cc[nH]c2c1=O |
| InChI | InChI=1S/C26H32N4O4/c1-5-7-10-30-17-21(18-8-9-27-24(18)26(30)32)19-15-23(34-4)20(16-22(19)33-3)25(31)29-13-11-28(6-2)12-14-29/h5,8-9,15-17,27H,1,6-7,10-14H2,2-4H3 |
| InChIKey | VMWDCBIIPKHTRX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|