C24H30N4O8S — CID 171527444
2-[[2-[carboxymethyl-[2-oxo-2-(4-sulfoanilino)ethyl]amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid (PubChem CID 171527444) has the molecular formula C24H30N4O8S and a molecular weight of 534.59 g/mol. Its IUPAC name is 2-[[2-[carboxymethyl-[2-oxo-2-(4-sulfoanilino)ethyl]amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid.
| Compound Name | 2-[[2-[carboxymethyl-[2-oxo-2-(4-sulfoanilino)ethyl]amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 171527444 |
| Molecular Formula | C24H30N4O8S |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 2-[[2-[carboxymethyl-[2-oxo-2-(4-sulfoanilino)ethyl]amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)Nc1ccc(S(=O)(=O)O)cc1)C1CCCCC1N(CC(=O)O)Cc1ccccn1 |
| InChI | InChI=1S/C24H30N4O8S/c29-22(26-17-8-10-19(11-9-17)37(34,35)36)14-28(16-24(32)33)21-7-2-1-6-20(21)27(15-23(30)31)13-18-5-3-4-12-25-18/h3-5,8-12,20-21H,1-2,6-7,13-16H2,(H,26,29)(H,30,31)(H,32,33)(H,34,35,36) |
| InChIKey | ATGGOPZMASJDLA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 177.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|