C31H34F6FeN5O3+2 — CID 171527516
2-[[(1S)-2-[[2-[3,5-bis(trifluoromethyl)phenyl]imino-2-hydroxyethyl]-(pyridin-2-ylmethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;carbanide;iron(3+) (PubChem CID 171527516) has the molecular formula C31H34F6FeN5O3+2 and a molecular weight of 694.48 g/mol. Its IUPAC name is 2-[[(1S)-2-[[2-[3,5-bis(trifluoromethyl)phenyl]imino-2-hydroxyethyl]-(pyridin-2-ylmethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;carbanide;iron(3+).
| Compound Name | 2-[[(1S)-2-[[2-[3,5-bis(trifluoromethyl)phenyl]imino-2-hydroxyethyl]-(pyridin-2-ylmethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;carbanide;iron(3+) |
|---|---|
| PubChem CID | 171527516 |
| Molecular Formula | C31H34F6FeN5O3+2 |
| Molecular Weight | 694.48 g/mol |
| Exact Mass | 694.19 |
| IUPAC Name | 2-[[(1S)-2-[[2-[3,5-bis(trifluoromethyl)phenyl]imino-2-hydroxyethyl]-(pyridin-2-ylmethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;carbanide;iron(3+) |
| SMILES | O=C(O)CN(Cc1ccccn1)[C@H]1CCCCC1N(C/C(O)=N\c1cc(C(F)(F)F)cc(C(F)(F)F)c1)Cc1ccccn1.[CH3-].[Fe+3] |
| InChI | InChI=1S/C30H31F6N5O3.CH3.Fe/c31-29(32,33)20-13-21(30(34,35)36)15-24(14-20)39-27(42)18-40(16-22-7-3-5-11-37-22)25-9-1-2-10-26(25)41(19-28(43)44)17-23-8-4-6-12-38-23;;/h3-8,11-15,25-26H,1-2,9-10,16-19H2,(H,39,42)(H,43,44);1H3;/q;-1;+3/t25?,26-;;/m0../s1 |
| InChIKey | FSOVOAFGKFBRRJ-IUALQQHBSA-N |
| XLogP | 6.95 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.48 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|