C26H32F3FeN4O5+2 — CID 171527529
carbanide;2-[[(1S)-2-[carboxymethyl-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]iminoethyl]amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron(3+) (PubChem CID 171527529) has the molecular formula C26H32F3FeN4O5+2 and a molecular weight of 593.40 g/mol. Its IUPAC name is carbanide;2-[[(1S)-2-[carboxymethyl-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]iminoethyl]amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron(3+).
| Compound Name | carbanide;2-[[(1S)-2-[carboxymethyl-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]iminoethyl]amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron(3+) |
|---|---|
| PubChem CID | 171527529 |
| Molecular Formula | C26H32F3FeN4O5+2 |
| Molecular Weight | 593.40 g/mol |
| Exact Mass | 593.17 |
| IUPAC Name | carbanide;2-[[(1S)-2-[carboxymethyl-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]iminoethyl]amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron(3+) |
| SMILES | O=C(O)CN(C/C(O)=N\c1ccc(C(F)(F)F)cc1)C1CCCC[C@@H]1N(CC(=O)O)Cc1ccccn1.[CH3-].[Fe+3] |
| InChI | InChI=1S/C25H29F3N4O5.CH3.Fe/c26-25(27,28)17-8-10-18(11-9-17)30-22(33)14-32(16-24(36)37)21-7-2-1-6-20(21)31(15-23(34)35)13-19-5-3-4-12-29-19;;/h3-5,8-12,20-21H,1-2,6-7,13-16H2,(H,30,33)(H,34,35)(H,36,37);1H3;/q;-1;+3/t20-,21?;;/m0../s1 |
| InChIKey | VOWIGIZFFVXEQS-OAQMNXJYSA-N |
| XLogP | 4.42 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|