C26H28F6FeN4O5+2 — CID 171527544
2-[[(1S)-2-[[2-[3,5-bis(trifluoromethyl)phenyl]imino-2-hydroxyethyl]-(carboxymethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron(2+) (PubChem CID 171527544) has the molecular formula C26H28F6FeN4O5+2 and a molecular weight of 646.37 g/mol. Its IUPAC name is 2-[[(1S)-2-[[2-[3,5-bis(trifluoromethyl)phenyl]imino-2-hydroxyethyl]-(carboxymethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron(2+).
| Compound Name | 2-[[(1S)-2-[[2-[3,5-bis(trifluoromethyl)phenyl]imino-2-hydroxyethyl]-(carboxymethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron(2+) |
|---|---|
| PubChem CID | 171527544 |
| Molecular Formula | C26H28F6FeN4O5+2 |
| Molecular Weight | 646.37 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | 2-[[(1S)-2-[[2-[3,5-bis(trifluoromethyl)phenyl]imino-2-hydroxyethyl]-(carboxymethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron(2+) |
| SMILES | O=C(O)CN(C/C(O)=N\c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCCC[C@@H]1N(CC(=O)O)Cc1ccccn1.[Fe+2] |
| InChI | InChI=1S/C26H28F6N4O5.Fe/c27-25(28,29)16-9-17(26(30,31)32)11-19(10-16)34-22(37)13-36(15-24(40)41)21-7-2-1-6-20(21)35(14-23(38)39)12-18-5-3-4-8-33-18;/h3-5,8-11,20-21H,1-2,6-7,12-15H2,(H,34,37)(H,38,39)(H,40,41);/q;+2/t20-,21?;/m0./s1 |
| InChIKey | TXTZSIACTDZLHQ-FQQMSVSDSA-N |
| XLogP | 4.99 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.37 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|