About 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one
6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one (PubChem CID 171527966) has the molecular formula C13H8BrF2N3O
and a molecular weight of 340.13 g/mol. Its IUPAC name is 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one.
Molecular Properties
| Compound Name | 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one |
| PubChem CID | 171527966 |
| Molecular Formula | C13H8BrF2N3O |
| Molecular Weight | 340.13 g/mol |
| Exact Mass | 338.98 |
| IUPAC Name | 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one |
| SMILES | O=C1c2nccnc2CN1Cc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C13H8BrF2N3O/c14-7-3-9(15)8(10(16)4-7)5-19-6-11-12(13(19)20)18-2-1-17-11/h1-4H,5-6H2 |
| InChIKey | CNNRXGMZUNYEEL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.13 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one?
The IUPAC name of 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one (CID 171527966) is 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one.
What is the SMILES notation for 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one?
The canonical SMILES for 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one is O=C1c2nccnc2CN1Cc1c(F)cc(Br)cc1F.
What is the InChIKey of 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one?
The InChIKey is CNNRXGMZUNYEEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8BrF2N3O/c14-7-3-9(15)8(10(16)4-7)5-19-6-11-12(13(19)20)18-2-1-17-11/h1-4H,5-6H2.
What are the key properties of 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one?
6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one has a molecular weight of 340.13 g/mol, XLogP of 2.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-bromo-2,6-difluorophenyl)methyl]-7H-pyrrolo[3,4-b]pyrazin-5-one is sourced from PubChem (CID 171527966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).