C20H20F2N2O2 — CID 171528499
4-[4-(3,5-difluoro-4-methylphenyl)-2-methylindazol-7-yl]oxan-4-ol (PubChem CID 171528499) has the molecular formula C20H20F2N2O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-[4-(3,5-difluoro-4-methylphenyl)-2-methylindazol-7-yl]oxan-4-ol.
| Compound Name | 4-[4-(3,5-difluoro-4-methylphenyl)-2-methylindazol-7-yl]oxan-4-ol |
|---|---|
| PubChem CID | 171528499 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-[4-(3,5-difluoro-4-methylphenyl)-2-methylindazol-7-yl]oxan-4-ol |
| SMILES | Cc1c(F)cc(-c2ccc(C3(O)CCOCC3)c3nn(C)cc23)cc1F |
| InChI | InChI=1S/C20H20F2N2O2/c1-12-17(21)9-13(10-18(12)22)14-3-4-16(19-15(14)11-24(2)23-19)20(25)5-7-26-8-6-20/h3-4,9-11,25H,5-8H2,1-2H3 |
| InChIKey | WHJWLNPHMOQMRV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |