C18H23N2O6P — CID 171528676
1-[3-methoxy-4-[(6-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]butyl]-5-methylpyrimidine-2,4-dione (PubChem CID 171528676) has the molecular formula C18H23N2O6P and a molecular weight of 394.36 g/mol. Its IUPAC name is 1-[3-methoxy-4-[(6-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]butyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[3-methoxy-4-[(6-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]butyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171528676 |
| Molecular Formula | C18H23N2O6P |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-[3-methoxy-4-[(6-methyl-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]butyl]-5-methylpyrimidine-2,4-dione |
| SMILES | COC(CCn1cc(C)c(=O)[nH]c1=O)COP1OCc2cc(C)ccc2O1 |
| InChI | InChI=1S/C18H23N2O6P/c1-12-4-5-16-14(8-12)10-24-27(26-16)25-11-15(23-3)6-7-20-9-13(2)17(21)19-18(20)22/h4-5,8-9,15H,6-7,10-11H2,1-3H3,(H,19,21,22) |
| InChIKey | PTJMLIYYHANNPJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|