C19H25FN3O11P — CID 171528823
[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl [3-methoxy-2-(pyridin-4-ylmethoxy)propyl] hydrogen phosphate (PubChem CID 171528823) has the molecular formula C19H25FN3O11P and a molecular weight of 521.39 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl [3-methoxy-2-(pyridin-4-ylmethoxy)propyl] hydrogen phosphate.
| Compound Name | [(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl [3-methoxy-2-(pyridin-4-ylmethoxy)propyl] hydrogen phosphate |
|---|---|
| PubChem CID | 171528823 |
| Molecular Formula | C19H25FN3O11P |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | [(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-fluoro-3,4-dihydroxyoxolan-2-yl]methyl [3-methoxy-2-(pyridin-4-ylmethoxy)propyl] hydrogen phosphate |
| SMILES | COCC(COP(=O)(O)OC[C@@]1(F)O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1O)OCc1ccncc1 |
| InChI | InChI=1S/C19H25FN3O11P/c1-30-9-13(31-8-12-2-5-21-6-3-12)10-32-35(28,29)33-11-19(20)16(26)15(25)17(34-19)23-7-4-14(24)22-18(23)27/h2-7,13,15-17,25-26H,8-11H2,1H3,(H,28,29)(H,22,24,27)/t13?,15-,16+,17-,19-/m1/s1 |
| InChIKey | RQJRNYQEWFUUHG-ZDODLEKNSA-N |
| XLogP | -0.79 |
| TPSA | 191.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|