C25H31F2N2O6P — CID 171528944
[1-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4-(5-ethynyl-2,4-dioxopyrimidin-1-yl)butan-2-yl] hypofluorite (PubChem CID 171528944) has the molecular formula C25H31F2N2O6P and a molecular weight of 524.50 g/mol. Its IUPAC name is [1-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4-(5-ethynyl-2,4-dioxopyrimidin-1-yl)butan-2-yl] hypofluorite.
| Compound Name | [1-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4-(5-ethynyl-2,4-dioxopyrimidin-1-yl)butan-2-yl] hypofluorite |
|---|---|
| PubChem CID | 171528944 |
| Molecular Formula | C25H31F2N2O6P |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | [1-[(6,8-ditert-butyl-5-fluoro-4H-1,3,2-benzodioxaphosphinin-2-yl)oxy]-4-(5-ethynyl-2,4-dioxopyrimidin-1-yl)butan-2-yl] hypofluorite |
| SMILES | C#Cc1cn(CCC(COP2OCc3c(F)c(C(C)(C)C)cc(C(C)(C)C)c3O2)OF)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H31F2N2O6P/c1-8-15-12-29(23(31)28-22(15)30)10-9-16(34-27)13-32-36-33-14-17-20(26)18(24(2,3)4)11-19(21(17)35-36)25(5,6)7/h1,11-12,16H,9-10,13-14H2,2-7H3,(H,28,30,31) |
| InChIKey | VQOSKAARNGSBRF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|