About (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene
(4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene (PubChem CID 171529210) has the molecular formula C9H12BrF
and a molecular weight of 219.10 g/mol. Its IUPAC name is (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene.
Molecular Properties
| Compound Name | (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene |
| PubChem CID | 171529210 |
| Molecular Formula | C9H12BrF |
| Molecular Weight | 219.10 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene |
| SMILES | C/C=C\C=C(\F)C(Br)=C(C)C |
| InChI | InChI=1S/C9H12BrF/c1-4-5-6-8(11)9(10)7(2)3/h4-6H,1-3H3/b5-4-,8-6+ |
| InChIKey | RLXULIMFAXMLDK-GSGSLZOQSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.10 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene?
The IUPAC name of (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene (CID 171529210) is (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene.
What is the SMILES notation for (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene?
The canonical SMILES for (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene is C/C=C\C=C(\F)C(Br)=C(C)C.
What is the InChIKey of (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene?
The InChIKey is RLXULIMFAXMLDK-GSGSLZOQSA-N. The full InChI is InChI=1S/C9H12BrF/c1-4-5-6-8(11)9(10)7(2)3/h4-6H,1-3H3/b5-4-,8-6+.
What are the key properties of (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene?
(4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene has a molecular weight of 219.10 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6Z)-3-bromo-4-fluoro-2-methylocta-2,4,6-triene is sourced from PubChem (CID 171529210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).