C24H24FN5O2 — CID 171529528
(17E)-22-amino-17-(1-aminoethylidene)-18-ethylimino-6-fluoro-2-oxa-11,21-diazatetracyclo[17.3.1.04,9.010,15]tricosa-1(22),4(9),5,7,10(15),13,19(23),20-octaen-16-one (PubChem CID 171529528) has the molecular formula C24H24FN5O2 and a molecular weight of 433.49 g/mol. Its IUPAC name is (17E)-22-amino-17-(1-aminoethylidene)-18-ethylimino-6-fluoro-2-oxa-11,21-diazatetracyclo[17.3.1.04,9.010,15]tricosa-1(22),4(9),5,7,10(15),13,19(23),20-octaen-16-one.
| Compound Name | (17E)-22-amino-17-(1-aminoethylidene)-18-ethylimino-6-fluoro-2-oxa-11,21-diazatetracyclo[17.3.1.04,9.010,15]tricosa-1(22),4(9),5,7,10(15),13,19(23),20-octaen-16-one |
|---|---|
| PubChem CID | 171529528 |
| Molecular Formula | C24H24FN5O2 |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (17E)-22-amino-17-(1-aminoethylidene)-18-ethylimino-6-fluoro-2-oxa-11,21-diazatetracyclo[17.3.1.04,9.010,15]tricosa-1(22),4(9),5,7,10(15),13,19(23),20-octaen-16-one |
| SMILES | CC/N=C1C(=C(/C)N)/C(=O)C2=C(NCC=C2)c2ccc(F)cc2COc2cc/1cnc2N |
| InChI | InChI=1S/C24H24FN5O2/c1-3-28-21-14-10-19(24(27)30-11-14)32-12-15-9-16(25)6-7-17(15)22-18(5-4-8-29-22)23(31)20(21)13(2)26/h4-7,9-11,29H,3,8,12,26H2,1-2H3,(H2,27,30)/b20-13+,28-21+ |
| InChIKey | YFPWPMVFILTHSP-CHLCIXFPSA-N |
| XLogP | 2.88 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|