C18H26F2N4OS — CID 171529979
N-cyclohexyl-N',N'-dimethylethane-1,2-diamine;N-(4,6-difluoro-1,3-benzothiazol-2-yl)formamide (PubChem CID 171529979) has the molecular formula C18H26F2N4OS and a molecular weight of 384.50 g/mol. Its IUPAC name is N-cyclohexyl-N',N'-dimethylethane-1,2-diamine;N-(4,6-difluoro-1,3-benzothiazol-2-yl)formamide.
| Compound Name | N-cyclohexyl-N',N'-dimethylethane-1,2-diamine;N-(4,6-difluoro-1,3-benzothiazol-2-yl)formamide |
|---|---|
| PubChem CID | 171529979 |
| Molecular Formula | C18H26F2N4OS |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | N-cyclohexyl-N',N'-dimethylethane-1,2-diamine;N-(4,6-difluoro-1,3-benzothiazol-2-yl)formamide |
| SMILES | CN(C)CCNC1CCCCC1.O=CNc1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C10H22N2.C8H4F2N2OS/c1-12(2)9-8-11-10-6-4-3-5-7-10;9-4-1-5(10)7-6(2-4)14-8(12-7)11-3-13/h10-11H,3-9H2,1-2H3;1-3H,(H,11,12,13) |
| InChIKey | DPBWFQXTUHKVFW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|