About 3,5-dichloropyridine
3,5-dichloropyridine (PubChem CID 17153) has the molecular formula C5H3Cl2N
and a molecular weight of 147.99 g/mol. Its IUPAC name is 3,5-dichloropyridine.
Molecular Properties
| Compound Name | 3,5-dichloropyridine |
| PubChem CID | 17153 |
| Molecular Formula | C5H3Cl2N |
| Molecular Weight | 147.99 g/mol |
| Exact Mass | 146.96 |
| IUPAC Name | 3,5-dichloropyridine |
| SMILES | Clc1cncc(Cl)c1 |
| InChI | InChI=1S/C5H3Cl2N/c6-4-1-5(7)3-8-2-4/h1-3H |
| InChIKey | WPGHPGAUFIJVJF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.99 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloropyridine?
The IUPAC name of 3,5-dichloropyridine (CID 17153) is 3,5-dichloropyridine.
What is the SMILES notation for 3,5-dichloropyridine?
The canonical SMILES for 3,5-dichloropyridine is Clc1cncc(Cl)c1.
What is the InChIKey of 3,5-dichloropyridine?
The InChIKey is WPGHPGAUFIJVJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3Cl2N/c6-4-1-5(7)3-8-2-4/h1-3H.
What are the key properties of 3,5-dichloropyridine?
3,5-dichloropyridine has a molecular weight of 147.99 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloropyridine is sourced from PubChem (CID 17153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).