C11H26N2O4 — CID 171530208
2-[2-[2-[2-(dimethylaminooxy)ethoxy]ethoxy]ethoxy]-N-methylethanamine (PubChem CID 171530208) has the molecular formula C11H26N2O4 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[2-[2-[2-(dimethylaminooxy)ethoxy]ethoxy]ethoxy]-N-methylethanamine.
| Compound Name | 2-[2-[2-[2-(dimethylaminooxy)ethoxy]ethoxy]ethoxy]-N-methylethanamine |
|---|---|
| PubChem CID | 171530208 |
| Molecular Formula | C11H26N2O4 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 2-[2-[2-[2-(dimethylaminooxy)ethoxy]ethoxy]ethoxy]-N-methylethanamine |
| SMILES | CNCCOCCOCCOCCON(C)C |
| InChI | InChI=1S/C11H26N2O4/c1-12-4-5-14-6-7-15-8-9-16-10-11-17-13(2)3/h12H,4-11H2,1-3H3 |
| InChIKey | OQSFIXLQADBQGP-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|