C26H29F4N7O2 — CID 171530827
5-[3-[8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-6-methoxy-N-methylpyridine-3-carboxamide (PubChem CID 171530827) has the molecular formula C26H29F4N7O2 and a molecular weight of 547.56 g/mol. Its IUPAC name is 5-[3-[8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-6-methoxy-N-methylpyridine-3-carboxamide.
| Compound Name | 5-[3-[8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-6-methoxy-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 171530827 |
| Molecular Formula | C26H29F4N7O2 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 5-[3-[8-[[(3S,4R)-3-fluoro-1-methylpiperidin-4-yl]amino]-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-2-yl]prop-2-ynylamino]-6-methoxy-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cnc(OC)c(NCC#Cc2nc3c(N[C@@H]4CCN(C)C[C@@H]4F)cccn3c2CC(F)(F)F)c1 |
| InChI | InChI=1S/C26H29F4N7O2/c1-31-24(38)16-12-21(25(39-3)33-14-16)32-9-4-6-19-22(13-26(28,29)30)37-10-5-7-20(23(37)35-19)34-18-8-11-36(2)15-17(18)27/h5,7,10,12,14,17-18,32,34H,8-9,11,13,15H2,1-3H3,(H,31,38)/t17-,18+/m0/s1 |
| InChIKey | SXBIVKKFQXEPAD-ZWKOTPCHSA-N |
| XLogP | 3.12 |
| TPSA | 95.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|