About 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen
3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen (PubChem CID 171531442) has the molecular formula C10H21F2NO
and a molecular weight of 209.28 g/mol. Its IUPAC name is 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen.
Molecular Properties
| Compound Name | 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen |
| PubChem CID | 171531442 |
| Molecular Formula | C10H21F2NO |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen |
| SMILES | COCC1CCC(F)(F)C(C(C)C)N1.[H][H] |
| InChI | InChI=1S/C10H19F2NO.H2/c1-7(2)9-10(11,12)5-4-8(13-9)6-14-3;/h7-9,13H,4-6H2,1-3H3;1H |
| InChIKey | JBMHOUJUGUGPGB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen?
The IUPAC name of 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen (CID 171531442) is 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen.
What is the SMILES notation for 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen?
The canonical SMILES for 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen is COCC1CCC(F)(F)C(C(C)C)N1.[H][H].
What is the InChIKey of 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen?
The InChIKey is JBMHOUJUGUGPGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2NO.H2/c1-7(2)9-10(11,12)5-4-8(13-9)6-14-3;/h7-9,13H,4-6H2,1-3H3;1H.
What are the key properties of 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen?
3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen has a molecular weight of 209.28 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-6-(methoxymethyl)-2-propan-2-ylpiperidine;molecular hydrogen is sourced from PubChem (CID 171531442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).