C8H15FN2 — CID 171531511
3a-fluoro-2,5-dimethyl-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 171531511) has the molecular formula C8H15FN2 and a molecular weight of 158.22 g/mol. Its IUPAC name is 3a-fluoro-2,5-dimethyl-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | 3a-fluoro-2,5-dimethyl-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 171531511 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 3a-fluoro-2,5-dimethyl-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | CC1CC2(F)CN(C)CC2N1 |
| InChI | InChI=1S/C8H15FN2/c1-6-3-8(9)5-11(2)4-7(8)10-6/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | HKOAVHYSQJUPLY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |