C12H28N2 — CID 171531580
3,7-dimethyl-3,6-diazabicyclo[3.2.1]octane;ethane (PubChem CID 171531580) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is 3,7-dimethyl-3,6-diazabicyclo[3.2.1]octane;ethane.
| Compound Name | 3,7-dimethyl-3,6-diazabicyclo[3.2.1]octane;ethane |
|---|---|
| PubChem CID | 171531580 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | 3,7-dimethyl-3,6-diazabicyclo[3.2.1]octane;ethane |
| SMILES | CC.CC.CC1NC2CC1CN(C)C2 |
| InChI | InChI=1S/C8H16N2.2C2H6/c1-6-7-3-8(9-6)5-10(2)4-7;2*1-2/h6-9H,3-5H2,1-2H3;2*1-2H3 |
| InChIKey | BLUGGJRMYABUBL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |