C10H6BrF3N2O — CID 171532151
8-bromo-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-2-carbaldehyde (PubChem CID 171532151) has the molecular formula C10H6BrF3N2O and a molecular weight of 307.07 g/mol. Its IUPAC name is 8-bromo-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-2-carbaldehyde.
| Compound Name | 8-bromo-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 171532151 |
| Molecular Formula | C10H6BrF3N2O |
| Molecular Weight | 307.07 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 8-bromo-3-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridine-2-carbaldehyde |
| SMILES | O=Cc1nc2c(Br)cccn2c1CC(F)(F)F |
| InChI | InChI=1S/C10H6BrF3N2O/c11-6-2-1-3-16-8(4-10(12,13)14)7(5-17)15-9(6)16/h1-3,5H,4H2 |
| InChIKey | FTOYKYLOTARDHV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.07 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|