C23H18N4O2S2 — CID 17153411
4-benzamido-N-[5-(phenylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 17153411) has the molecular formula C23H18N4O2S2 and a molecular weight of 446.56 g/mol. Its IUPAC name is 4-benzamido-N-[5-(phenylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-benzamido-N-[5-(phenylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 17153411 |
| Molecular Formula | C23H18N4O2S2 |
| Molecular Weight | 446.56 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 4-benzamido-N-[5-(phenylsulfanylmethyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)Nc2nnc(CSc3ccccc3)s2)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H18N4O2S2/c28-21(16-7-3-1-4-8-16)24-18-13-11-17(12-14-18)22(29)25-23-27-26-20(31-23)15-30-19-9-5-2-6-10-19/h1-14H,15H2,(H,24,28)(H,25,27,29) |
| InChIKey | KLOWSDZMVZZQPP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |