About 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide
5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide (PubChem CID 171534769) has the molecular formula C19H24BrN5O2
and a molecular weight of 434.34 g/mol. Its IUPAC name is 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide |
| PubChem CID | 171534769 |
| Molecular Formula | C19H24BrN5O2 |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide |
| SMILES | COC(C)Cc1nc2c(C)c(Br)ccc2n1C.Cc1cnc(C(N)=O)cn1 |
| InChI | InChI=1S/C13H17BrN2O.C6H7N3O/c1-8(17-4)7-12-15-13-9(2)10(14)5-6-11(13)16(12)3;1-4-2-9-5(3-8-4)6(7)10/h5-6,8H,7H2,1-4H3;2-3H,1H3,(H2,7,10) |
| InChIKey | QNHXOOGMUTYZDH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide?
The IUPAC name of 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide (CID 171534769) is 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide.
What is the SMILES notation for 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide?
The canonical SMILES for 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide is COC(C)Cc1nc2c(C)c(Br)ccc2n1C.Cc1cnc(C(N)=O)cn1.
What is the InChIKey of 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide?
The InChIKey is QNHXOOGMUTYZDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrN2O.C6H7N3O/c1-8(17-4)7-12-15-13-9(2)10(14)5-6-11(13)16(12)3;1-4-2-9-5(3-8-4)6(7)10/h5-6,8H,7H2,1-4H3;2-3H,1H3,(H2,7,10).
What are the key properties of 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide?
5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide has a molecular weight of 434.34 g/mol, XLogP of 3.11, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(2-methoxypropyl)-1,4-dimethylbenzimidazole;5-methylpyrazine-2-carboxamide is sourced from PubChem (CID 171534769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).