C19H22FN2O2+ — CID 171535802
2-cyclopentyloxy-1-[2-[(3-fluoro-2-pyridinyl)oxy]cyclopropyl]-5-methylpyridin-1-ium (PubChem CID 171535802) has the molecular formula C19H22FN2O2+ and a molecular weight of 329.39 g/mol. Its IUPAC name is 2-cyclopentyloxy-1-[2-[(3-fluoro-2-pyridinyl)oxy]cyclopropyl]-5-methylpyridin-1-ium.
| Compound Name | 2-cyclopentyloxy-1-[2-[(3-fluoro-2-pyridinyl)oxy]cyclopropyl]-5-methylpyridin-1-ium |
|---|---|
| PubChem CID | 171535802 |
| Molecular Formula | C19H22FN2O2+ |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-cyclopentyloxy-1-[2-[(3-fluoro-2-pyridinyl)oxy]cyclopropyl]-5-methylpyridin-1-ium |
| SMILES | Cc1ccc(OC2CCCC2)[n+](C2CC2Oc2ncccc2F)c1 |
| InChI | InChI=1S/C19H22FN2O2/c1-13-8-9-18(23-14-5-2-3-6-14)22(12-13)16-11-17(16)24-19-15(20)7-4-10-21-19/h4,7-10,12,14,16-17H,2-3,5-6,11H2,1H3/q+1 |
| InChIKey | DJRXFZODAFLAHD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|