About ethane;6-fluoro-4,5-dimethylisoquinoline
ethane;6-fluoro-4,5-dimethylisoquinoline (PubChem CID 171535835) has the molecular formula C13H16FN
and a molecular weight of 205.28 g/mol. Its IUPAC name is ethane;6-fluoro-4,5-dimethylisoquinoline.
Molecular Properties
| Compound Name | ethane;6-fluoro-4,5-dimethylisoquinoline |
| PubChem CID | 171535835 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | ethane;6-fluoro-4,5-dimethylisoquinoline |
| SMILES | CC.Cc1cncc2ccc(F)c(C)c12 |
| InChI | InChI=1S/C11H10FN.C2H6/c1-7-5-13-6-9-3-4-10(12)8(2)11(7)9;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | UBWYMKKVKCKEGZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;6-fluoro-4,5-dimethylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-fluoro-4,5-dimethylisoquinoline?
The IUPAC name of ethane;6-fluoro-4,5-dimethylisoquinoline (CID 171535835) is ethane;6-fluoro-4,5-dimethylisoquinoline.
What is the SMILES notation for ethane;6-fluoro-4,5-dimethylisoquinoline?
The canonical SMILES for ethane;6-fluoro-4,5-dimethylisoquinoline is CC.Cc1cncc2ccc(F)c(C)c12.
What is the InChIKey of ethane;6-fluoro-4,5-dimethylisoquinoline?
The InChIKey is UBWYMKKVKCKEGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN.C2H6/c1-7-5-13-6-9-3-4-10(12)8(2)11(7)9;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of ethane;6-fluoro-4,5-dimethylisoquinoline?
ethane;6-fluoro-4,5-dimethylisoquinoline has a molecular weight of 205.28 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-fluoro-4,5-dimethylisoquinoline is sourced from PubChem (CID 171535835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).