C28H48N4O6Si — CID 171536595
1-butyl-3-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]cyclohexyl]-5-(hydroxymethyl)-6-methylpyrimidine-2,4-dione (PubChem CID 171536595) has the molecular formula C28H48N4O6Si and a molecular weight of 564.80 g/mol. Its IUPAC name is 1-butyl-3-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]cyclohexyl]-5-(hydroxymethyl)-6-methylpyrimidine-2,4-dione.
| Compound Name | 1-butyl-3-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]cyclohexyl]-5-(hydroxymethyl)-6-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171536595 |
| Molecular Formula | C28H48N4O6Si |
| Molecular Weight | 564.80 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | 1-butyl-3-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]cyclohexyl]-5-(hydroxymethyl)-6-methylpyrimidine-2,4-dione |
| SMILES | CCCCn1c(C)c(CO)c(=O)n(C2CCC(CN3C(=O)N(COCC[Si](C)(C)C)C(=O)C3(C)C)CC2)c1=O |
| InChI | InChI=1S/C28H48N4O6Si/c1-8-9-14-29-20(2)23(18-33)24(34)32(27(29)37)22-12-10-21(11-13-22)17-31-26(36)30(25(35)28(31,3)4)19-38-15-16-39(5,6)7/h21-22,33H,8-19H2,1-7H3 |
| InChIKey | CTKOZNLCWVNWDZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 114.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|