C28H42N6O5SSi — CID 171536796
7-butyl-5-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]cyclohexyl]-4,6-dioxo-[1,2]thiazolo[3,4-d]pyrimidine-3-carbonitrile (PubChem CID 171536796) has the molecular formula C28H42N6O5SSi and a molecular weight of 602.83 g/mol. Its IUPAC name is 7-butyl-5-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]cyclohexyl]-4,6-dioxo-[1,2]thiazolo[3,4-d]pyrimidine-3-carbonitrile.
| Compound Name | 7-butyl-5-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]cyclohexyl]-4,6-dioxo-[1,2]thiazolo[3,4-d]pyrimidine-3-carbonitrile |
|---|---|
| PubChem CID | 171536796 |
| Molecular Formula | C28H42N6O5SSi |
| Molecular Weight | 602.83 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 7-butyl-5-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]cyclohexyl]-4,6-dioxo-[1,2]thiazolo[3,4-d]pyrimidine-3-carbonitrile |
| SMILES | CCCCn1c(=O)n(C2CCC(CN3C(=O)N(COCC[Si](C)(C)C)C(=O)C3(C)C)CC2)c(=O)c2c(C#N)snc21 |
| InChI | InChI=1S/C28H42N6O5SSi/c1-7-8-13-31-23-22(21(16-29)40-30-23)24(35)34(27(31)38)20-11-9-19(10-12-20)17-33-26(37)32(25(36)28(33,2)3)18-39-14-15-41(4,5)6/h19-20H,7-15,17-18H2,1-6H3 |
| InChIKey | CNIOQXCBHNJZCS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 130.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.83 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|