About 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine
2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine (PubChem CID 171538303) has the molecular formula C21H30ClNO
and a molecular weight of 347.93 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine |
| PubChem CID | 171538303 |
| Molecular Formula | C21H30ClNO |
| Molecular Weight | 347.93 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine |
| SMILES | CC1C=CC=CN1.CC1CC1.CCC(C=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H13ClO.C6H9N.C4H8/c1-2-9(8-13)7-10-3-5-11(12)6-4-10;1-6-4-2-3-5-7-6;1-4-2-3-4/h3-6,8-9H,2,7H2,1H3;2-7H,1H3;4H,2-3H2,1H3 |
| InChIKey | HYEZBBJRCXDXQG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.93 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine?
The IUPAC name of 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine (CID 171538303) is 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine.
What is the SMILES notation for 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine?
The canonical SMILES for 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine is CC1C=CC=CN1.CC1CC1.CCC(C=O)Cc1ccc(Cl)cc1.
What is the InChIKey of 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine?
The InChIKey is HYEZBBJRCXDXQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO.C6H9N.C4H8/c1-2-9(8-13)7-10-3-5-11(12)6-4-10;1-6-4-2-3-5-7-6;1-4-2-3-4/h3-6,8-9H,2,7H2,1H3;2-7H,1H3;4H,2-3H2,1H3.
What are the key properties of 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine?
2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine has a molecular weight of 347.93 g/mol, XLogP of 5.57, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chlorophenyl)methyl]butanal;methylcyclopropane;2-methyl-1,2-dihydropyridine is sourced from PubChem (CID 171538303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).