C36H46N2O12 — CID 171538505
N-cyclopentylformamide;(9R)-10-methoxy-6-methyl-5,8,11-trioxa-1-azatricyclo[7.4.0.02,7]tridecane;6,8,10,11-tetrahydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione (PubChem CID 171538505) has the molecular formula C36H46N2O12 and a molecular weight of 698.77 g/mol. Its IUPAC name is N-cyclopentylformamide;(9R)-10-methoxy-6-methyl-5,8,11-trioxa-1-azatricyclo[7.4.0.02,7]tridecane;6,8,10,11-tetrahydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione.
| Compound Name | N-cyclopentylformamide;(9R)-10-methoxy-6-methyl-5,8,11-trioxa-1-azatricyclo[7.4.0.02,7]tridecane;6,8,10,11-tetrahydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 171538505 |
| Molecular Formula | C36H46N2O12 |
| Molecular Weight | 698.77 g/mol |
| Exact Mass | 698.31 |
| IUPAC Name | N-cyclopentylformamide;(9R)-10-methoxy-6-methyl-5,8,11-trioxa-1-azatricyclo[7.4.0.02,7]tridecane;6,8,10,11-tetrahydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
| SMILES | COC1OCCN2C3CCOC(C)C3O[C@H]12.COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)CC3O.O=CNC1CCCC1 |
| InChI | InChI=1S/C19H16O7.C11H19NO4.C6H11NO/c1-26-11-4-2-3-8-13(11)19(25)15-14(16(8)22)17(23)9-5-7(20)6-10(21)12(9)18(15)24;1-7-9-8(3-5-14-7)12-4-6-15-11(13-2)10(12)16-9;8-5-7-6-3-1-2-4-6/h2-4,7,10,20-21,23-24H,5-6H2,1H3;7-11H,3-6H2,1-2H3;5-6H,1-4H2,(H,7,8)/t;7?,8?,9?,10-,11?;/m.1./s1 |
| InChIKey | MFDIDUCOPLOXDV-LXXYIHBMSA-N |
| XLogP | 2.09 |
| TPSA | 193.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.77 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|