C29H41FN6 — CID 171539449
(3aR,7aR)-4-(3-fluorophenyl)-1-[4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-2-pyridinyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine (PubChem CID 171539449) has the molecular formula C29H41FN6 and a molecular weight of 492.69 g/mol. Its IUPAC name is (3aR,7aR)-4-(3-fluorophenyl)-1-[4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-2-pyridinyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine.
| Compound Name | (3aR,7aR)-4-(3-fluorophenyl)-1-[4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-2-pyridinyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 171539449 |
| Molecular Formula | C29H41FN6 |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.34 |
| IUPAC Name | (3aR,7aR)-4-(3-fluorophenyl)-1-[4-[4-[(4-methylpiperazin-1-yl)methyl]piperidin-1-yl]-2-pyridinyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine |
| SMILES | CN1CCN(CC2CCN(c3ccnc(N4CC[C@@H]5[C@H]4CCCN5c4cccc(F)c4)c3)CC2)CC1 |
| InChI | InChI=1S/C29H41FN6/c1-32-16-18-33(19-17-32)22-23-8-13-34(14-9-23)25-7-11-31-29(21-25)36-15-10-28-27(36)6-3-12-35(28)26-5-2-4-24(30)20-26/h2,4-5,7,11,20-21,23,27-28H,3,6,8-10,12-19,22H2,1H3/t27-,28-/m1/s1 |
| InChIKey | WKMGZNYEKOQPRU-VSGBNLITSA-N |
| XLogP | 3.93 |
| TPSA | 29.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |