C25H22ClN3O3 — CID 17153972
N-[4-[(2-chlorophenyl)methylcarbamoyl]phenyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 17153972) has the molecular formula C25H22ClN3O3 and a molecular weight of 447.92 g/mol. Its IUPAC name is N-[4-[(2-chlorophenyl)methylcarbamoyl]phenyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-[4-[(2-chlorophenyl)methylcarbamoyl]phenyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17153972 |
| Molecular Formula | C25H22ClN3O3 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[4-[(2-chlorophenyl)methylcarbamoyl]phenyl]-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)c1ccc(NC(=O)C2CC(=O)N(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H22ClN3O3/c26-22-9-5-4-6-18(22)15-27-24(31)17-10-12-20(13-11-17)28-25(32)19-14-23(30)29(16-19)21-7-2-1-3-8-21/h1-13,19H,14-16H2,(H,27,31)(H,28,32) |
| InChIKey | JNNQXULAFODHJI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |