About 4-amino-2-chlorobenzoic acid
4-amino-2-chlorobenzoic acid (PubChem CID 17154) has the molecular formula C7H6ClNO2
and a molecular weight of 171.58 g/mol. Its IUPAC name is 4-amino-2-chlorobenzoic acid.
Molecular Properties
| Compound Name | 4-amino-2-chlorobenzoic acid |
| PubChem CID | 17154 |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | 171.58 g/mol |
| Exact Mass | 171.01 |
| IUPAC Name | 4-amino-2-chlorobenzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C7H6ClNO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | MBDUKNCPOPMRJQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.58 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-chlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-chlorobenzoic acid?
The IUPAC name of 4-amino-2-chlorobenzoic acid (CID 17154) is 4-amino-2-chlorobenzoic acid.
What is the SMILES notation for 4-amino-2-chlorobenzoic acid?
The canonical SMILES for 4-amino-2-chlorobenzoic acid is Nc1ccc(C(=O)O)c(Cl)c1.
What is the InChIKey of 4-amino-2-chlorobenzoic acid?
The InChIKey is MBDUKNCPOPMRJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,9H2,(H,10,11).
What are the key properties of 4-amino-2-chlorobenzoic acid?
4-amino-2-chlorobenzoic acid has a molecular weight of 171.58 g/mol, XLogP of 1.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-chlorobenzoic acid is sourced from PubChem (CID 17154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).