C22H26N6O — CID 171540071
4-morpholin-4-yl-N-[(3R)-1-quinolin-5-ylpiperidin-3-yl]pyrimidin-2-amine (PubChem CID 171540071) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 4-morpholin-4-yl-N-[(3R)-1-quinolin-5-ylpiperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-morpholin-4-yl-N-[(3R)-1-quinolin-5-ylpiperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 171540071 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 4-morpholin-4-yl-N-[(3R)-1-quinolin-5-ylpiperidin-3-yl]pyrimidin-2-amine |
| SMILES | c1cc(N2CCC[C@@H](Nc3nccc(N4CCOCC4)n3)C2)c2cccnc2c1 |
| InChI | InChI=1S/C22H26N6O/c1-6-19-18(5-2-9-23-19)20(7-1)28-11-3-4-17(16-28)25-22-24-10-8-21(26-22)27-12-14-29-15-13-27/h1-2,5-10,17H,3-4,11-16H2,(H,24,25,26)/t17-/m1/s1 |
| InChIKey | NWJNOGHWIRKPGB-QGZVFWFLSA-N |
| XLogP | 2.94 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |