About butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen
butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen (PubChem CID 171540494) has the molecular formula C18H36N2O
and a molecular weight of 296.50 g/mol. Its IUPAC name is butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen.
Molecular Properties
| Compound Name | butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen |
| PubChem CID | 171540494 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen |
| SMILES | CCC(C)NCCC#CC#CCCNC(C)=O.CCCC.[H][H].[H][H] |
| InChI | InChI=1S/C14H22N2O.C4H10.2H2/c1-4-13(2)15-11-9-7-5-6-8-10-12-16-14(3)17;1-3-4-2;;/h13,15H,4,9-12H2,1-3H3,(H,16,17);3-4H2,1-2H3;2*1H |
| InChIKey | MFGXYDLBHFKMSD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen?
The IUPAC name of butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen (CID 171540494) is butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen.
What is the SMILES notation for butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen?
The canonical SMILES for butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen is CCC(C)NCCC#CC#CCCNC(C)=O.CCCC.[H][H].[H][H].
What is the InChIKey of butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen?
The InChIKey is MFGXYDLBHFKMSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O.C4H10.2H2/c1-4-13(2)15-11-9-7-5-6-8-10-12-16-14(3)17;1-3-4-2;;/h13,15H,4,9-12H2,1-3H3,(H,16,17);3-4H2,1-2H3;2*1H.
What are the key properties of butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen?
butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen has a molecular weight of 296.50 g/mol, XLogP of 3.60, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;N-[8-(butan-2-ylamino)octa-3,5-diynyl]acetamide;molecular hydrogen is sourced from PubChem (CID 171540494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).