C14H15Cl2N3O2 — CID 171541166
3-[4-(3-aminoazetidin-1-yl)-2,6-dichlorophenyl]piperidine-2,6-dione (PubChem CID 171541166) has the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.20 g/mol. Its IUPAC name is 3-[4-(3-aminoazetidin-1-yl)-2,6-dichlorophenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-(3-aminoazetidin-1-yl)-2,6-dichlorophenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171541166 |
| Molecular Formula | C14H15Cl2N3O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 3-[4-(3-aminoazetidin-1-yl)-2,6-dichlorophenyl]piperidine-2,6-dione |
| SMILES | NC1CN(c2cc(Cl)c(C3CCC(=O)NC3=O)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H15Cl2N3O2/c15-10-3-8(19-5-7(17)6-19)4-11(16)13(10)9-1-2-12(20)18-14(9)21/h3-4,7,9H,1-2,5-6,17H2,(H,18,20,21) |
| InChIKey | HRAYBQQCYPCTIB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|